C8H12N2 — CID 129180673
6-ethynyl-2,6-diazaspiro[3.4]octane (PubChem CID 129180673) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 6-ethynyl-2,6-diazaspiro[3.4]octane.
| Compound Name | 6-ethynyl-2,6-diazaspiro[3.4]octane |
|---|---|
| PubChem CID | 129180673 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 6-ethynyl-2,6-diazaspiro[3.4]octane |
| SMILES | C#CN1CCC2(CNC2)C1 |
| InChI | InChI=1S/C8H12N2/c1-2-10-4-3-8(7-10)5-9-6-8/h1,9H,3-7H2 |
| InChIKey | YTFAWLCWDMKNRX-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|