C21H20N4O2 — CID 137378594
N-[2-(1'-cyano-2-oxospiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-6-yl)phenyl]acetamide (PubChem CID 137378594) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is N-[2-(1'-cyano-2-oxospiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-6-yl)phenyl]acetamide.
| Compound Name | N-[2-(1'-cyano-2-oxospiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-6-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 137378594 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-[2-(1'-cyano-2-oxospiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-6-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccccc1-c1ccc2c(c1)CC1(CCN(C#N)C1)C(=O)N2 |
| InChI | InChI=1S/C21H20N4O2/c1-14(26)23-19-5-3-2-4-17(19)15-6-7-18-16(10-15)11-21(20(27)24-18)8-9-25(12-21)13-22/h2-7,10H,8-9,11-12H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | FVPCYEDRHMZEGW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|