C26H23N3O2 — CID 137378561
2-oxo-6-(4-phenylmethoxyphenyl)spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-1'-carbonitrile (PubChem CID 137378561) has the molecular formula C26H23N3O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-oxo-6-(4-phenylmethoxyphenyl)spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-1'-carbonitrile.
| Compound Name | 2-oxo-6-(4-phenylmethoxyphenyl)spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-1'-carbonitrile |
|---|---|
| PubChem CID | 137378561 |
| Molecular Formula | C26H23N3O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 2-oxo-6-(4-phenylmethoxyphenyl)spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-1'-carbonitrile |
| SMILES | N#CN1CCC2(Cc3cc(-c4ccc(OCc5ccccc5)cc4)ccc3NC2=O)C1 |
| InChI | InChI=1S/C26H23N3O2/c27-18-29-13-12-26(17-29)15-22-14-21(8-11-24(22)28-25(26)30)20-6-9-23(10-7-20)31-16-19-4-2-1-3-5-19/h1-11,14H,12-13,15-17H2,(H,28,30) |
| InChIKey | ZEDBVTZEWNUZIU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|