C9H18NOPW — CID 169041366
1-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethoxyphosphane;tungsten (PubChem CID 169041366) has the molecular formula C9H18NOPW and a molecular weight of 371.06 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethoxyphosphane;tungsten.
| Compound Name | 1-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethoxyphosphane;tungsten |
|---|---|
| PubChem CID | 169041366 |
| Molecular Formula | C9H18NOPW |
| Molecular Weight | 371.06 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethoxyphosphane;tungsten |
| SMILES | CC(OP)C12CCCN1CCC2.[W] |
| InChI | InChI=1S/C9H18NOP.W/c1-8(11-12)9-4-2-6-10(9)7-3-5-9;/h8H,2-7,12H2,1H3; |
| InChIKey | KAPJMIKWPIFTRF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.06 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|