C11H22NOP — CID 171590791
2-methyl-8a-propan-2-yl-1,3,4,6,7,8-hexahydropyrrolo[1,2-a][1,4]azaphosphinine 2-oxide (PubChem CID 171590791) has the molecular formula C11H22NOP and a molecular weight of 215.28 g/mol. Its IUPAC name is 2-methyl-8a-propan-2-yl-1,3,4,6,7,8-hexahydropyrrolo[1,2-a][1,4]azaphosphinine 2-oxide.
| Compound Name | 2-methyl-8a-propan-2-yl-1,3,4,6,7,8-hexahydropyrrolo[1,2-a][1,4]azaphosphinine 2-oxide |
|---|---|
| PubChem CID | 171590791 |
| Molecular Formula | C11H22NOP |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 2-methyl-8a-propan-2-yl-1,3,4,6,7,8-hexahydropyrrolo[1,2-a][1,4]azaphosphinine 2-oxide |
| SMILES | CC(C)C12CCCN1CCP(C)(=O)C2 |
| InChI | InChI=1S/C11H22NOP/c1-10(2)11-5-4-6-12(11)7-8-14(3,13)9-11/h10H,4-9H2,1-3H3 |
| InChIKey | XNORQBKDWCTOLK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|