C12H21BNP — CID 175625806
CID 175625806 (PubChem CID 175625806) has the molecular formula C12H21BNP and a molecular weight of 221.09 g/mol.
| Compound Name | CID 175625806 |
|---|---|
| PubChem CID | 175625806 |
| Molecular Formula | C12H21BNP |
| Molecular Weight | 221.09 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | — |
| SMILES | [B]C1(P)CC12CN1CCCC1(C(C)C)C2 |
| InChI | InChI=1S/C12H21BNP/c1-9(2)11-4-3-5-14(11)8-10(6-11)7-12(10,13)15/h9H,3-8,15H2,1-2H3 |
| InChIKey | RQPKCCCHPDFOCC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.09 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|