C26H41N5 — CID 177002721
4-methyl-7-[3-(4-methylpiperazin-1-yl)propyl]-3-(octan-4-ylideneamino)quinolin-2-amine (PubChem CID 177002721) has the molecular formula C26H41N5 and a molecular weight of 423.65 g/mol. Its IUPAC name is 4-methyl-7-[3-(4-methylpiperazin-1-yl)propyl]-3-(octan-4-ylideneamino)quinolin-2-amine.
| Compound Name | 4-methyl-7-[3-(4-methylpiperazin-1-yl)propyl]-3-(octan-4-ylideneamino)quinolin-2-amine |
|---|---|
| PubChem CID | 177002721 |
| Molecular Formula | C26H41N5 |
| Molecular Weight | 423.65 g/mol |
| Exact Mass | 423.34 |
| IUPAC Name | 4-methyl-7-[3-(4-methylpiperazin-1-yl)propyl]-3-(octan-4-ylideneamino)quinolin-2-amine |
| SMILES | CCCC/C(CCC)=N/c1c(N)nc2cc(CCCN3CCN(C)CC3)ccc2c1C |
| InChI | InChI=1S/C26H41N5/c1-5-7-11-22(9-6-2)28-25-20(3)23-13-12-21(19-24(23)29-26(25)27)10-8-14-31-17-15-30(4)16-18-31/h12-13,19H,5-11,14-18H2,1-4H3,(H2,27,29)/b28-22+ |
| InChIKey | SXMUMEURWOWEIE-XAYXJRQQSA-N |
| XLogP | 5.37 |
| TPSA | 57.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.65 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|