C25H39N5 — CID 177002867
7-[3-(4-tert-butylpiperazin-1-yl)propyl]-3-(pentylideneamino)quinolin-2-amine (PubChem CID 177002867) has the molecular formula C25H39N5 and a molecular weight of 409.62 g/mol. Its IUPAC name is 7-[3-(4-tert-butylpiperazin-1-yl)propyl]-3-(pentylideneamino)quinolin-2-amine.
| Compound Name | 7-[3-(4-tert-butylpiperazin-1-yl)propyl]-3-(pentylideneamino)quinolin-2-amine |
|---|---|
| PubChem CID | 177002867 |
| Molecular Formula | C25H39N5 |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 409.32 |
| IUPAC Name | 7-[3-(4-tert-butylpiperazin-1-yl)propyl]-3-(pentylideneamino)quinolin-2-amine |
| SMILES | CCCC/C=N/c1cc2ccc(CCCN3CCN(C(C)(C)C)CC3)cc2nc1N |
| InChI | InChI=1S/C25H39N5/c1-5-6-7-12-27-23-19-21-11-10-20(18-22(21)28-24(23)26)9-8-13-29-14-16-30(17-15-29)25(2,3)4/h10-12,18-19H,5-9,13-17H2,1-4H3,(H2,26,28)/b27-12+ |
| InChIKey | PFZOKROMSPBNLU-KKMKTNMSSA-N |
| XLogP | 5.06 |
| TPSA | 57.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|