C23H25ClFN5O2 — CID 177004215
3-(aminomethylidene)-1-[5-chloro-2-[[(1S)-1-cyclopropyl-2-hydroxyethyl]amino]-4-pyridinyl]-4-[(2-fluorophenyl)methylimino]piperidin-2-one (PubChem CID 177004215) has the molecular formula C23H25ClFN5O2 and a molecular weight of 457.94 g/mol. Its IUPAC name is 3-(aminomethylidene)-1-[5-chloro-2-[[(1S)-1-cyclopropyl-2-hydroxyethyl]amino]-4-pyridinyl]-4-[(2-fluorophenyl)methylimino]piperidin-2-one.
| Compound Name | 3-(aminomethylidene)-1-[5-chloro-2-[[(1S)-1-cyclopropyl-2-hydroxyethyl]amino]-4-pyridinyl]-4-[(2-fluorophenyl)methylimino]piperidin-2-one |
|---|---|
| PubChem CID | 177004215 |
| Molecular Formula | C23H25ClFN5O2 |
| Molecular Weight | 457.94 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 3-(aminomethylidene)-1-[5-chloro-2-[[(1S)-1-cyclopropyl-2-hydroxyethyl]amino]-4-pyridinyl]-4-[(2-fluorophenyl)methylimino]piperidin-2-one |
| SMILES | NC=C1C(=O)N(c2cc(N[C@H](CO)C3CC3)ncc2Cl)CC/C1=N\Cc1ccccc1F |
| InChI | InChI=1S/C23H25ClFN5O2/c24-17-12-28-22(29-20(13-31)14-5-6-14)9-21(17)30-8-7-19(16(10-26)23(30)32)27-11-15-3-1-2-4-18(15)25/h1-4,9-10,12,14,20,31H,5-8,11,13,26H2,(H,28,29)/b16-10?,27-19+/t20-/m1/s1 |
| InChIKey | IHUUTPMESZCYIH-GVMXHNJMSA-N |
| XLogP | 3.28 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.94 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|