About 3-(2,2-difluoro-5-azaspiro[2.3]hexan-5-yl)-6-methyl-6-azaspiro[3.4]octane;ethane
3-(2,2-difluoro-5-azaspiro[2.3]hexan-5-yl)-6-methyl-6-azaspiro[3.4]octane;ethane (PubChem CID 177005779) has the molecular formula C15H26F2N2
and a molecular weight of 272.38 g/mol. Its IUPAC name is 3-(2,2-difluoro-5-azaspiro[2.3]hexan-5-yl)-6-methyl-6-azaspiro[3.4]octane;ethane.
Molecular Properties
| Compound Name | 3-(2,2-difluoro-5-azaspiro[2.3]hexan-5-yl)-6-methyl-6-azaspiro[3.4]octane;ethane |
| PubChem CID | 177005779 |
| Molecular Formula | C15H26F2N2 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 3-(2,2-difluoro-5-azaspiro[2.3]hexan-5-yl)-6-methyl-6-azaspiro[3.4]octane;ethane |
| SMILES | CC.CN1CCC2(CCC2N2CC3(C2)CC3(F)F)C1 |
| InChI | InChI=1S/C13H20F2N2.C2H6/c1-16-5-4-11(7-16)3-2-10(11)17-8-12(9-17)6-13(12,14)15;1-2/h10H,2-9H2,1H3;1-2H3 |
| InChIKey | PGPBMCQHHQPRSB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2,2-difluoro-5-azaspiro[2.3]hexan-5-yl)-6-methyl-6-azaspiro[3.4]octane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluoro-5-azaspiro[2.3]hexan-5-yl)-6-methyl-6-azaspiro[3.4]octane;ethane?
The IUPAC name of 3-(2,2-difluoro-5-azaspiro[2.3]hexan-5-yl)-6-methyl-6-azaspiro[3.4]octane;ethane (CID 177005779) is 3-(2,2-difluoro-5-azaspiro[2.3]hexan-5-yl)-6-methyl-6-azaspiro[3.4]octane;ethane.
What is the SMILES notation for 3-(2,2-difluoro-5-azaspiro[2.3]hexan-5-yl)-6-methyl-6-azaspiro[3.4]octane;ethane?
The canonical SMILES for 3-(2,2-difluoro-5-azaspiro[2.3]hexan-5-yl)-6-methyl-6-azaspiro[3.4]octane;ethane is CC.CN1CCC2(CCC2N2CC3(C2)CC3(F)F)C1.
What is the InChIKey of 3-(2,2-difluoro-5-azaspiro[2.3]hexan-5-yl)-6-methyl-6-azaspiro[3.4]octane;ethane?
The InChIKey is PGPBMCQHHQPRSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F2N2.C2H6/c1-16-5-4-11(7-16)3-2-10(11)17-8-12(9-17)6-13(12,14)15;1-2/h10H,2-9H2,1H3;1-2H3.
What are the key properties of 3-(2,2-difluoro-5-azaspiro[2.3]hexan-5-yl)-6-methyl-6-azaspiro[3.4]octane;ethane?
3-(2,2-difluoro-5-azaspiro[2.3]hexan-5-yl)-6-methyl-6-azaspiro[3.4]octane;ethane has a molecular weight of 272.38 g/mol, XLogP of 2.84, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoro-5-azaspiro[2.3]hexan-5-yl)-6-methyl-6-azaspiro[3.4]octane;ethane is sourced from PubChem (CID 177005779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).