C6H9FN2 — CID 177006222
6-fluoro-N-methyl-1,2-dihydropyridin-2-amine (PubChem CID 177006222) has the molecular formula C6H9FN2 and a molecular weight of 128.15 g/mol. Its IUPAC name is 6-fluoro-N-methyl-1,2-dihydropyridin-2-amine.
| Compound Name | 6-fluoro-N-methyl-1,2-dihydropyridin-2-amine |
|---|---|
| PubChem CID | 177006222 |
| Molecular Formula | C6H9FN2 |
| Molecular Weight | 128.15 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | 6-fluoro-N-methyl-1,2-dihydropyridin-2-amine |
| SMILES | CNC1C=CC=C(F)N1 |
| InChI | InChI=1S/C6H9FN2/c1-8-6-4-2-3-5(7)9-6/h2-4,6,8-9H,1H3 |
| InChIKey | ORQLRBLNDBXISZ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.15 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|