C9H16FNO — CID 177009188
(7S,7aS)-4-fluoro-1,7-dimethyl-3,3a,4,5,7,7a-hexahydro-2H-pyrano[3,4-b]pyrrole (PubChem CID 177009188) has the molecular formula C9H16FNO and a molecular weight of 173.23 g/mol. Its IUPAC name is (7S,7aS)-4-fluoro-1,7-dimethyl-3,3a,4,5,7,7a-hexahydro-2H-pyrano[3,4-b]pyrrole.
| Compound Name | (7S,7aS)-4-fluoro-1,7-dimethyl-3,3a,4,5,7,7a-hexahydro-2H-pyrano[3,4-b]pyrrole |
|---|---|
| PubChem CID | 177009188 |
| Molecular Formula | C9H16FNO |
| Molecular Weight | 173.23 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (7S,7aS)-4-fluoro-1,7-dimethyl-3,3a,4,5,7,7a-hexahydro-2H-pyrano[3,4-b]pyrrole |
| SMILES | C[C@@H]1OCC(F)C2CCN(C)[C@@H]21 |
| InChI | InChI=1S/C9H16FNO/c1-6-9-7(3-4-11(9)2)8(10)5-12-6/h6-9H,3-5H2,1-2H3/t6-,7?,8?,9+/m0/s1 |
| InChIKey | DSKVOJDRUBLWGD-DFAZKQQPSA-N |
| XLogP | 1.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |