C11H20FNO — CID 177009965
(3Z)-3-(fluoromethylidene)-1-methyl-2-[(1S)-1-propan-2-yloxyethyl]pyrrolidine (PubChem CID 177009965) has the molecular formula C11H20FNO and a molecular weight of 201.28 g/mol. Its IUPAC name is (3Z)-3-(fluoromethylidene)-1-methyl-2-[(1S)-1-propan-2-yloxyethyl]pyrrolidine.
| Compound Name | (3Z)-3-(fluoromethylidene)-1-methyl-2-[(1S)-1-propan-2-yloxyethyl]pyrrolidine |
|---|---|
| PubChem CID | 177009965 |
| Molecular Formula | C11H20FNO |
| Molecular Weight | 201.28 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (3Z)-3-(fluoromethylidene)-1-methyl-2-[(1S)-1-propan-2-yloxyethyl]pyrrolidine |
| SMILES | CC(C)O[C@@H](C)C1/C(=C\F)CCN1C |
| InChI | InChI=1S/C11H20FNO/c1-8(2)14-9(3)11-10(7-12)5-6-13(11)4/h7-9,11H,5-6H2,1-4H3/b10-7-/t9-,11?/m0/s1 |
| InChIKey | IKCFNYQHMICBAU-FRRDIBPTSA-N |
| XLogP | 2.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |