C13H20N2O4S — CID 177011043
3-[(3-methylsulfonylanilino)methyl]piperidine-2,6-dione;molecular hydrogen (PubChem CID 177011043) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is 3-[(3-methylsulfonylanilino)methyl]piperidine-2,6-dione;molecular hydrogen.
| Compound Name | 3-[(3-methylsulfonylanilino)methyl]piperidine-2,6-dione;molecular hydrogen |
|---|---|
| PubChem CID | 177011043 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 3-[(3-methylsulfonylanilino)methyl]piperidine-2,6-dione;molecular hydrogen |
| SMILES | CS(=O)(=O)c1cccc(NCC2CCC(=O)NC2=O)c1.[H][H].[H][H] |
| InChI | InChI=1S/C13H16N2O4S.2H2/c1-20(18,19)11-4-2-3-10(7-11)14-8-9-5-6-12(16)15-13(9)17;;/h2-4,7,9,14H,5-6,8H2,1H3,(H,15,16,17);2*1H |
| InChIKey | CNGJSHWYPZRLEJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|