C25H28FN5O3 — CID 177011459
6-amino-3-fluoro-2-[3-(1-oxa-8-azaspiro[4.5]decan-3-yl)-4-oxoquinazolin-6-yl]oxybenzonitrile;ethane (PubChem CID 177011459) has the molecular formula C25H28FN5O3 and a molecular weight of 465.53 g/mol. Its IUPAC name is 6-amino-3-fluoro-2-[3-(1-oxa-8-azaspiro[4.5]decan-3-yl)-4-oxoquinazolin-6-yl]oxybenzonitrile;ethane.
| Compound Name | 6-amino-3-fluoro-2-[3-(1-oxa-8-azaspiro[4.5]decan-3-yl)-4-oxoquinazolin-6-yl]oxybenzonitrile;ethane |
|---|---|
| PubChem CID | 177011459 |
| Molecular Formula | C25H28FN5O3 |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 6-amino-3-fluoro-2-[3-(1-oxa-8-azaspiro[4.5]decan-3-yl)-4-oxoquinazolin-6-yl]oxybenzonitrile;ethane |
| SMILES | CC.N#Cc1c(N)ccc(F)c1Oc1ccc2ncn(C3COC4(CCNCC4)C3)c(=O)c2c1 |
| InChI | InChI=1S/C23H22FN5O3.C2H6/c24-18-2-3-19(26)17(11-25)21(18)32-15-1-4-20-16(9-15)22(30)29(13-28-20)14-10-23(31-12-14)5-7-27-8-6-23;1-2/h1-4,9,13-14,27H,5-8,10,12,26H2;1-2H3 |
| InChIKey | VKTKMPFRQPYZGL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|