C28H30FN5O4S — CID 177011463
3-fluoro-2-[3-(1-oxa-8-azaspiro[4.5]decan-3-yl)-4-oxoquinazolin-6-yl]oxy-6-(oxan-4-ylsulfanylamino)benzonitrile (PubChem CID 177011463) has the molecular formula C28H30FN5O4S and a molecular weight of 551.64 g/mol. Its IUPAC name is 3-fluoro-2-[3-(1-oxa-8-azaspiro[4.5]decan-3-yl)-4-oxoquinazolin-6-yl]oxy-6-(oxan-4-ylsulfanylamino)benzonitrile.
| Compound Name | 3-fluoro-2-[3-(1-oxa-8-azaspiro[4.5]decan-3-yl)-4-oxoquinazolin-6-yl]oxy-6-(oxan-4-ylsulfanylamino)benzonitrile |
|---|---|
| PubChem CID | 177011463 |
| Molecular Formula | C28H30FN5O4S |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | 3-fluoro-2-[3-(1-oxa-8-azaspiro[4.5]decan-3-yl)-4-oxoquinazolin-6-yl]oxy-6-(oxan-4-ylsulfanylamino)benzonitrile |
| SMILES | N#Cc1c(NSC2CCOCC2)ccc(F)c1Oc1ccc2ncn(C3COC4(CCNCC4)C3)c(=O)c2c1 |
| InChI | InChI=1S/C28H30FN5O4S/c29-23-2-4-25(33-39-20-5-11-36-12-6-20)22(15-30)26(23)38-19-1-3-24-21(13-19)27(35)34(17-32-24)18-14-28(37-16-18)7-9-31-10-8-28/h1-4,13,17-18,20,31,33H,5-12,14,16H2 |
| InChIKey | JSJJEMZGTMUILR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|