C31H39FN4O2S — CID 177011298
6-(cyclopentylsulfanylamino)-2-[3-(3-ethyl-3-propylcyclobutyl)-4-oxoquinazolin-6-yl]oxy-3-fluorobenzonitrile;ethane (PubChem CID 177011298) has the molecular formula C31H39FN4O2S and a molecular weight of 550.74 g/mol. Its IUPAC name is 6-(cyclopentylsulfanylamino)-2-[3-(3-ethyl-3-propylcyclobutyl)-4-oxoquinazolin-6-yl]oxy-3-fluorobenzonitrile;ethane.
| Compound Name | 6-(cyclopentylsulfanylamino)-2-[3-(3-ethyl-3-propylcyclobutyl)-4-oxoquinazolin-6-yl]oxy-3-fluorobenzonitrile;ethane |
|---|---|
| PubChem CID | 177011298 |
| Molecular Formula | C31H39FN4O2S |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | 6-(cyclopentylsulfanylamino)-2-[3-(3-ethyl-3-propylcyclobutyl)-4-oxoquinazolin-6-yl]oxy-3-fluorobenzonitrile;ethane |
| SMILES | CC.CCCC1(CC)CC(n2cnc3ccc(Oc4c(F)ccc(NSC5CCCC5)c4C#N)cc3c2=O)C1 |
| InChI | InChI=1S/C29H33FN4O2S.C2H6/c1-3-13-29(4-2)15-19(16-29)34-18-32-25-11-9-20(14-22(25)28(34)35)36-27-23(17-31)26(12-10-24(27)30)33-37-21-7-5-6-8-21;1-2/h9-12,14,18-19,21,33H,3-8,13,15-16H2,1-2H3;1-2H3 |
| InChIKey | NSTVULKRKQWGON-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|