C27H30FN5O2S — CID 166169061
6-(cyclopentylsulfanylamino)-3-fluoro-2-[4-oxo-3-(2-piperidin-4-ylethyl)quinazolin-6-yl]oxybenzonitrile (PubChem CID 166169061) has the molecular formula C27H30FN5O2S and a molecular weight of 507.64 g/mol. Its IUPAC name is 6-(cyclopentylsulfanylamino)-3-fluoro-2-[4-oxo-3-(2-piperidin-4-ylethyl)quinazolin-6-yl]oxybenzonitrile.
| Compound Name | 6-(cyclopentylsulfanylamino)-3-fluoro-2-[4-oxo-3-(2-piperidin-4-ylethyl)quinazolin-6-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 166169061 |
| Molecular Formula | C27H30FN5O2S |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 6-(cyclopentylsulfanylamino)-3-fluoro-2-[4-oxo-3-(2-piperidin-4-ylethyl)quinazolin-6-yl]oxybenzonitrile |
| SMILES | N#Cc1c(NSC2CCCC2)ccc(F)c1Oc1ccc2ncn(CCC3CCNCC3)c(=O)c2c1 |
| InChI | InChI=1S/C27H30FN5O2S/c28-23-6-8-25(32-36-20-3-1-2-4-20)22(16-29)26(23)35-19-5-7-24-21(15-19)27(34)33(17-31-24)14-11-18-9-12-30-13-10-18/h5-8,15,17-18,20,30,32H,1-4,9-14H2 |
| InChIKey | HEVFJZKACLHXSV-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 91.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|