C23H22F2N4O4 — CID 164529525
tert-butyl N-[3-[6-(2-cyano-3,6-difluorophenoxy)-4-oxoquinazolin-3-yl]propyl]carbamate (PubChem CID 164529525) has the molecular formula C23H22F2N4O4 and a molecular weight of 456.45 g/mol. Its IUPAC name is tert-butyl N-[3-[6-(2-cyano-3,6-difluorophenoxy)-4-oxoquinazolin-3-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[6-(2-cyano-3,6-difluorophenoxy)-4-oxoquinazolin-3-yl]propyl]carbamate |
|---|---|
| PubChem CID | 164529525 |
| Molecular Formula | C23H22F2N4O4 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | tert-butyl N-[3-[6-(2-cyano-3,6-difluorophenoxy)-4-oxoquinazolin-3-yl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCn1cnc2ccc(Oc3c(F)ccc(F)c3C#N)cc2c1=O |
| InChI | InChI=1S/C23H22F2N4O4/c1-23(2,3)33-22(31)27-9-4-10-29-13-28-19-8-5-14(11-15(19)21(29)30)32-20-16(12-26)17(24)6-7-18(20)25/h5-8,11,13H,4,9-10H2,1-3H3,(H,27,31) |
| InChIKey | AQVUZNDMRZPYSJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|