C17H11F3N4O2 — CID 176812814
6-amino-3,4-difluoro-2-[3-(2-fluoroethyl)-4-oxoquinazolin-6-yl]oxybenzonitrile (PubChem CID 176812814) has the molecular formula C17H11F3N4O2 and a molecular weight of 360.30 g/mol. Its IUPAC name is 6-amino-3,4-difluoro-2-[3-(2-fluoroethyl)-4-oxoquinazolin-6-yl]oxybenzonitrile.
| Compound Name | 6-amino-3,4-difluoro-2-[3-(2-fluoroethyl)-4-oxoquinazolin-6-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 176812814 |
| Molecular Formula | C17H11F3N4O2 |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 6-amino-3,4-difluoro-2-[3-(2-fluoroethyl)-4-oxoquinazolin-6-yl]oxybenzonitrile |
| SMILES | N#Cc1c(N)cc(F)c(F)c1Oc1ccc2ncn(CCF)c(=O)c2c1 |
| InChI | InChI=1S/C17H11F3N4O2/c18-3-4-24-8-23-14-2-1-9(5-10(14)17(24)25)26-16-11(7-21)13(22)6-12(19)15(16)20/h1-2,5-6,8H,3-4,22H2 |
| InChIKey | XKEZBRIKBQOHNG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|