C24H25FN6O2S — CID 177011919
2-[3-(2-azaspiro[3.3]heptan-6-yloxy)quinoxalin-6-yl]oxy-6-[[ethyl(methyl)amino]sulfanylamino]-3-fluorobenzonitrile (PubChem CID 177011919) has the molecular formula C24H25FN6O2S and a molecular weight of 480.57 g/mol. Its IUPAC name is 2-[3-(2-azaspiro[3.3]heptan-6-yloxy)quinoxalin-6-yl]oxy-6-[[ethyl(methyl)amino]sulfanylamino]-3-fluorobenzonitrile.
| Compound Name | 2-[3-(2-azaspiro[3.3]heptan-6-yloxy)quinoxalin-6-yl]oxy-6-[[ethyl(methyl)amino]sulfanylamino]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 177011919 |
| Molecular Formula | C24H25FN6O2S |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 2-[3-(2-azaspiro[3.3]heptan-6-yloxy)quinoxalin-6-yl]oxy-6-[[ethyl(methyl)amino]sulfanylamino]-3-fluorobenzonitrile |
| SMILES | CCN(C)SNc1ccc(F)c(Oc2ccc3ncc(OC4CC5(CNC5)C4)nc3c2)c1C#N |
| InChI | InChI=1S/C24H25FN6O2S/c1-3-31(2)34-30-19-7-5-18(25)23(17(19)11-26)33-15-4-6-20-21(8-15)29-22(12-28-20)32-16-9-24(10-16)13-27-14-24/h4-8,12,16,27,30H,3,9-10,13-14H2,1-2H3 |
| InChIKey | YREFLOQLUATXCY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|