C19H20FN5O2S2 — CID 177010592
S-methyl 2-(aminomethylideneamino)-5-[2-cyano-3-[[ethyl(methyl)amino]sulfanylamino]-6-fluorophenoxy]benzenecarbothioate (PubChem CID 177010592) has the molecular formula C19H20FN5O2S2 and a molecular weight of 433.53 g/mol. Its IUPAC name is S-methyl 2-(aminomethylideneamino)-5-[2-cyano-3-[[ethyl(methyl)amino]sulfanylamino]-6-fluorophenoxy]benzenecarbothioate.
| Compound Name | S-methyl 2-(aminomethylideneamino)-5-[2-cyano-3-[[ethyl(methyl)amino]sulfanylamino]-6-fluorophenoxy]benzenecarbothioate |
|---|---|
| PubChem CID | 177010592 |
| Molecular Formula | C19H20FN5O2S2 |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | S-methyl 2-(aminomethylideneamino)-5-[2-cyano-3-[[ethyl(methyl)amino]sulfanylamino]-6-fluorophenoxy]benzenecarbothioate |
| SMILES | CCN(C)SNc1ccc(F)c(Oc2ccc(/N=C/N)c(C(=O)SC)c2)c1C#N |
| InChI | InChI=1S/C19H20FN5O2S2/c1-4-25(2)29-24-17-8-6-15(20)18(14(17)10-21)27-12-5-7-16(23-11-22)13(9-12)19(26)28-3/h5-9,11,24H,4H2,1-3H3,(H2,22,23) |
| InChIKey | UUONRSLTWRBNOM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 103.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|