C29H25F4N4O4+ — CID 177013150
[(3Z,4S,5S)-3-[amino(carboxy)methylidene]-1-ethyl-4-(4-fluorophenyl)-6-oxo-5-[[3-(trifluoromethyl)benzoyl]amino]piperidin-2-ylidene]-phenylazanium (PubChem CID 177013150) has the molecular formula C29H25F4N4O4+ and a molecular weight of 569.54 g/mol. Its IUPAC name is [(3Z,4S,5S)-3-[amino(carboxy)methylidene]-1-ethyl-4-(4-fluorophenyl)-6-oxo-5-[[3-(trifluoromethyl)benzoyl]amino]piperidin-2-ylidene]-phenylazanium.
| Compound Name | [(3Z,4S,5S)-3-[amino(carboxy)methylidene]-1-ethyl-4-(4-fluorophenyl)-6-oxo-5-[[3-(trifluoromethyl)benzoyl]amino]piperidin-2-ylidene]-phenylazanium |
|---|---|
| PubChem CID | 177013150 |
| Molecular Formula | C29H25F4N4O4+ |
| Molecular Weight | 569.54 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | [(3Z,4S,5S)-3-[amino(carboxy)methylidene]-1-ethyl-4-(4-fluorophenyl)-6-oxo-5-[[3-(trifluoromethyl)benzoyl]amino]piperidin-2-ylidene]-phenylazanium |
| SMILES | CCN1C(=O)[C@@H](NC(=O)c2cccc(C(F)(F)F)c2)[C@@H](c2ccc(F)cc2)C(=C(/N)C(=O)O)/C1=[NH+]/c1ccccc1 |
| InChI | InChI=1S/C29H24F4N4O4/c1-2-37-25(35-20-9-4-3-5-10-20)22(23(34)28(40)41)21(16-11-13-19(30)14-12-16)24(27(37)39)36-26(38)17-7-6-8-18(15-17)29(31,32)33/h3-15,21,24H,2,34H2,1H3,(H,36,38)(H,40,41)/p+1/b23-22-,35-25-/t21-,24-/m0/s1 |
| InChIKey | RPVXAMZEBZDSKR-NKQYFXBCSA-O |
| XLogP | 2.70 |
| TPSA | 126.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.54 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|