C19H27F3N2O7 — CID 177015285
2-[2-(2-formamidoethoxy)ethoxy]acetic acid;2-(2-methyloxan-3-yl)oxy-6-(trifluoromethyl)pyridine (PubChem CID 177015285) has the molecular formula C19H27F3N2O7 and a molecular weight of 452.43 g/mol. Its IUPAC name is 2-[2-(2-formamidoethoxy)ethoxy]acetic acid;2-(2-methyloxan-3-yl)oxy-6-(trifluoromethyl)pyridine.
| Compound Name | 2-[2-(2-formamidoethoxy)ethoxy]acetic acid;2-(2-methyloxan-3-yl)oxy-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 177015285 |
| Molecular Formula | C19H27F3N2O7 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 2-[2-(2-formamidoethoxy)ethoxy]acetic acid;2-(2-methyloxan-3-yl)oxy-6-(trifluoromethyl)pyridine |
| SMILES | CC1OCCCC1Oc1cccc(C(F)(F)F)n1.O=CNCCOCCOCC(=O)O |
| InChI | InChI=1S/C12H14F3NO2.C7H13NO5/c1-8-9(4-3-7-17-8)18-11-6-2-5-10(16-11)12(13,14)15;9-6-8-1-2-12-3-4-13-5-7(10)11/h2,5-6,8-9H,3-4,7H2,1H3;6H,1-5H2,(H,8,9)(H,10,11) |
| InChIKey | PTJGKGUBBHCELW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|