C14H18F4N4O5 — CID 177015456
N'-acetyl-3,4-dihydroxypiperidine-1-carbohydrazide;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite (PubChem CID 177015456) has the molecular formula C14H18F4N4O5 and a molecular weight of 398.31 g/mol. Its IUPAC name is N'-acetyl-3,4-dihydroxypiperidine-1-carbohydrazide;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite.
| Compound Name | N'-acetyl-3,4-dihydroxypiperidine-1-carbohydrazide;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite |
|---|---|
| PubChem CID | 177015456 |
| Molecular Formula | C14H18F4N4O5 |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N'-acetyl-3,4-dihydroxypiperidine-1-carbohydrazide;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite |
| SMILES | CC(=O)NNC(=O)N1CCC(O)C(O)C1.FOc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H15N3O4.C6H3F4NO/c1-5(12)9-10-8(15)11-3-2-6(13)7(14)4-11;7-6(8,9)4-2-1-3-5(11-4)12-10/h6-7,13-14H,2-4H2,1H3,(H,9,12)(H,10,15);1-3H |
| InChIKey | DZDCXJUPMSROGI-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 124.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|