C19H28F4N4O5 — CID 178007795
N'-acetyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carbohydrazide;ethane;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite (PubChem CID 178007795) has the molecular formula C19H28F4N4O5 and a molecular weight of 468.45 g/mol. Its IUPAC name is N'-acetyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carbohydrazide;ethane;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite.
| Compound Name | N'-acetyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carbohydrazide;ethane;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite |
|---|---|
| PubChem CID | 178007795 |
| Molecular Formula | C19H28F4N4O5 |
| Molecular Weight | 468.45 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | N'-acetyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carbohydrazide;ethane;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite |
| SMILES | CC.CC(=O)NNC(=O)N1CCC2OC(C)(C)OC2C1.FOc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H19N3O4.C6H3F4NO.C2H6/c1-7(15)12-13-10(16)14-5-4-8-9(6-14)18-11(2,3)17-8;7-6(8,9)4-2-1-3-5(11-4)12-10;1-2/h8-9H,4-6H2,1-3H3,(H,12,15)(H,13,16);1-3H;1-2H3 |
| InChIKey | CGMINNGZZCGZLB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|