C14H18F4N2O3 — CID 178008312
2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridine;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite (PubChem CID 178008312) has the molecular formula C14H18F4N2O3 and a molecular weight of 338.30 g/mol. Its IUPAC name is 2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridine;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite.
| Compound Name | 2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridine;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite |
|---|---|
| PubChem CID | 178008312 |
| Molecular Formula | C14H18F4N2O3 |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridine;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite |
| SMILES | CC1(C)OC2CCNCC2O1.FOc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H15NO2.C6H3F4NO/c1-8(2)10-6-3-4-9-5-7(6)11-8;7-6(8,9)4-2-1-3-5(11-4)12-10/h6-7,9H,3-5H2,1-2H3;1-3H |
| InChIKey | RLQRHWHVTRTTKO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |