C21H25F4NO4 — CID 171557145
benzene;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite;2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran (PubChem CID 171557145) has the molecular formula C21H25F4NO4 and a molecular weight of 431.43 g/mol. Its IUPAC name is benzene;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite;2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran.
| Compound Name | benzene;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite;2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran |
|---|---|
| PubChem CID | 171557145 |
| Molecular Formula | C21H25F4NO4 |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | benzene;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite;2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran |
| SMILES | CC1OCCC2OC(C)(C)OC12.FOc1cccc(C(F)(F)F)n1.c1ccccc1 |
| InChI | InChI=1S/C9H16O3.C6H3F4NO.C6H6/c1-6-8-7(4-5-10-6)11-9(2,3)12-8;7-6(8,9)4-2-1-3-5(11-4)12-10;1-2-4-6-5-3-1/h6-8H,4-5H2,1-3H3;1-3H;1-6H |
| InChIKey | LQTWWJAUVRBPCI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |