C16H17F4NO4 — CID 171556975
4-ethynyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite (PubChem CID 171556975) has the molecular formula C16H17F4NO4 and a molecular weight of 363.31 g/mol. Its IUPAC name is 4-ethynyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite.
| Compound Name | 4-ethynyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite |
|---|---|
| PubChem CID | 171556975 |
| Molecular Formula | C16H17F4NO4 |
| Molecular Weight | 363.31 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 4-ethynyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite |
| SMILES | C#CC1OCCC2OC(C)(C)OC12.FOc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H14O3.C6H3F4NO/c1-4-7-9-8(5-6-11-7)12-10(2,3)13-9;7-6(8,9)4-2-1-3-5(11-4)12-10/h1,7-9H,5-6H2,2-3H3;1-3H |
| InChIKey | OXRWYOXVDFFJDR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|