C13H13F4NO4 — CID 171557121
2-ethynyloxane-3,4-diol;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite (PubChem CID 171557121) has the molecular formula C13H13F4NO4 and a molecular weight of 323.24 g/mol. Its IUPAC name is 2-ethynyloxane-3,4-diol;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite.
| Compound Name | 2-ethynyloxane-3,4-diol;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite |
|---|---|
| PubChem CID | 171557121 |
| Molecular Formula | C13H13F4NO4 |
| Molecular Weight | 323.24 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 2-ethynyloxane-3,4-diol;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite |
| SMILES | C#CC1OCCC(O)C1O.FOc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C7H10O3.C6H3F4NO/c1-2-6-7(9)5(8)3-4-10-6;7-6(8,9)4-2-1-3-5(11-4)12-10/h1,5-9H,3-4H2;1-3H |
| InChIKey | YBBLLOYONZQZHE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|