C15H18F4INO5S — CID 171556990
(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methoxy thiohypoiodite;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite (PubChem CID 171556990) has the molecular formula C15H18F4INO5S and a molecular weight of 527.27 g/mol. Its IUPAC name is (2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methoxy thiohypoiodite;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite.
| Compound Name | (2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methoxy thiohypoiodite;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite |
|---|---|
| PubChem CID | 171556990 |
| Molecular Formula | C15H18F4INO5S |
| Molecular Weight | 527.27 g/mol |
| Exact Mass | 526.99 |
| IUPAC Name | (2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methoxy thiohypoiodite;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite |
| SMILES | CC1(C)OC2CCOC(COSI)C2O1.FOc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H15IO4S.C6H3F4NO/c1-9(2)13-6-3-4-11-7(5-12-15-10)8(6)14-9;7-6(8,9)4-2-1-3-5(11-4)12-10/h6-8H,3-5H2,1-2H3;1-3H |
| InChIKey | XDJQQUWIMCIVEY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 59.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.27 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|