C15H20F4N2O4 — CID 171557989
(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methanamine;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite (PubChem CID 171557989) has the molecular formula C15H20F4N2O4 and a molecular weight of 368.33 g/mol. Its IUPAC name is (2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methanamine;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite.
| Compound Name | (2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methanamine;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite |
|---|---|
| PubChem CID | 171557989 |
| Molecular Formula | C15H20F4N2O4 |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methanamine;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite |
| SMILES | CC1(C)OC2CCOC(CN)C2O1.FOc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H17NO3.C6H3F4NO/c1-9(2)12-6-3-4-11-7(5-10)8(6)13-9;7-6(8,9)4-2-1-3-5(11-4)12-10/h6-8H,3-5,10H2,1-2H3;1-3H |
| InChIKey | MMHGBWMRLMORDT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |