C15H18F3NO4 — CID 171558455
2-[[(4R,7S,7aR)-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy]-6-(trifluoromethyl)pyridine (PubChem CID 171558455) has the molecular formula C15H18F3NO4 and a molecular weight of 333.31 g/mol. Its IUPAC name is 2-[[(4R,7S,7aR)-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy]-6-(trifluoromethyl)pyridine.
| Compound Name | 2-[[(4R,7S,7aR)-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy]-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 171558455 |
| Molecular Formula | C15H18F3NO4 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 2-[[(4R,7S,7aR)-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy]-6-(trifluoromethyl)pyridine |
| SMILES | C[C@H]1OC[C@H](Oc2cccc(C(F)(F)F)n2)[C@H]2OC(C)(C)OC12 |
| InChI | InChI=1S/C15H18F3NO4/c1-8-12-13(23-14(2,3)22-12)9(7-20-8)21-11-6-4-5-10(19-11)15(16,17)18/h4-6,8-9,12-13H,7H2,1-3H3/t8-,9+,12?,13-/m1/s1 |
| InChIKey | YEKUGFNPSMJUPJ-CEWYYZTQSA-N |
| XLogP | 2.79 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |