C40H47F3N4O5 — CID 177015715
(3R,5R,6S)-6-[4-[4-[4-[4-[4-(2-aminoethyl)-2-methylphenoxy]phenoxy]butyl]piperazin-1-yl]phenyl]-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-3-ol (PubChem CID 177015715) has the molecular formula C40H47F3N4O5 and a molecular weight of 720.83 g/mol. Its IUPAC name is (3R,5R,6S)-6-[4-[4-[4-[4-[4-(2-aminoethyl)-2-methylphenoxy]phenoxy]butyl]piperazin-1-yl]phenyl]-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-3-ol.
| Compound Name | (3R,5R,6S)-6-[4-[4-[4-[4-[4-(2-aminoethyl)-2-methylphenoxy]phenoxy]butyl]piperazin-1-yl]phenyl]-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-3-ol |
|---|---|
| PubChem CID | 177015715 |
| Molecular Formula | C40H47F3N4O5 |
| Molecular Weight | 720.83 g/mol |
| Exact Mass | 720.35 |
| IUPAC Name | (3R,5R,6S)-6-[4-[4-[4-[4-[4-(2-aminoethyl)-2-methylphenoxy]phenoxy]butyl]piperazin-1-yl]phenyl]-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-3-ol |
| SMILES | Cc1cc(CCN)ccc1Oc1ccc(OCCCCN2CCN(c3ccc([C@@H]4OC[C@H](O)C[C@H]4Oc4cccc(C(F)(F)F)n4)cc3)CC2)cc1 |
| InChI | InChI=1S/C40H47F3N4O5/c1-28-25-29(17-18-44)7-16-35(28)51-34-14-12-33(13-15-34)49-24-3-2-19-46-20-22-47(23-21-46)31-10-8-30(9-11-31)39-36(26-32(48)27-50-39)52-38-6-4-5-37(45-38)40(41,42)43/h4-16,25,32,36,39,48H,2-3,17-24,26-27,44H2,1H3/t32-,36-,39+/m1/s1 |
| InChIKey | SVJFBDMJWJNNJT-NDBVVIGKSA-N |
| XLogP | 6.95 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.83 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|