C17H18F3N3O5 — CID 177015857
6-methoxypyridazine-3-carboxylic acid;2-(oxan-3-yloxy)-6-(trifluoromethyl)pyridine (PubChem CID 177015857) has the molecular formula C17H18F3N3O5 and a molecular weight of 401.34 g/mol. Its IUPAC name is 6-methoxypyridazine-3-carboxylic acid;2-(oxan-3-yloxy)-6-(trifluoromethyl)pyridine.
| Compound Name | 6-methoxypyridazine-3-carboxylic acid;2-(oxan-3-yloxy)-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 177015857 |
| Molecular Formula | C17H18F3N3O5 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 6-methoxypyridazine-3-carboxylic acid;2-(oxan-3-yloxy)-6-(trifluoromethyl)pyridine |
| SMILES | COc1ccc(C(=O)O)nn1.FC(F)(F)c1cccc(OC2CCCOC2)n1 |
| InChI | InChI=1S/C11H12F3NO2.C6H6N2O3/c12-11(13,14)9-4-1-5-10(15-9)17-8-3-2-6-16-7-8;1-11-5-3-2-4(6(9)10)7-8-5/h1,4-5,8H,2-3,6-7H2;2-3H,1H3,(H,9,10) |
| InChIKey | ZPQVHYLVWDUJTN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 103.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |