C10H17NO — CID 177016385
4-[(3Z)-penta-1,3-dien-3-yl]piperidin-4-ol (PubChem CID 177016385) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 4-[(3Z)-penta-1,3-dien-3-yl]piperidin-4-ol.
| Compound Name | 4-[(3Z)-penta-1,3-dien-3-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 177016385 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 4-[(3Z)-penta-1,3-dien-3-yl]piperidin-4-ol |
| SMILES | C=C/C(=C/C)C1(O)CCNCC1 |
| InChI | InChI=1S/C10H17NO/c1-3-9(4-2)10(12)5-7-11-8-6-10/h3-4,11-12H,1,5-8H2,2H3/b9-4- |
| InChIKey | MGVBKIZLTMSHAO-WTKPLQERSA-N |
| XLogP | 1.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|