C25H27FN4O3 — CID 177016528
3-[5-fluoro-6-[3-hydroxy-3-methyl-1-(1H-pyrrol-2-ylmethyl)piperidin-4-yl]quinolin-3-yl]piperidine-2,6-dione (PubChem CID 177016528) has the molecular formula C25H27FN4O3 and a molecular weight of 450.51 g/mol. Its IUPAC name is 3-[5-fluoro-6-[3-hydroxy-3-methyl-1-(1H-pyrrol-2-ylmethyl)piperidin-4-yl]quinolin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-6-[3-hydroxy-3-methyl-1-(1H-pyrrol-2-ylmethyl)piperidin-4-yl]quinolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177016528 |
| Molecular Formula | C25H27FN4O3 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 3-[5-fluoro-6-[3-hydroxy-3-methyl-1-(1H-pyrrol-2-ylmethyl)piperidin-4-yl]quinolin-3-yl]piperidine-2,6-dione |
| SMILES | CC1(O)CN(Cc2ccc[nH]2)CCC1c1ccc2ncc(C3CCC(=O)NC3=O)cc2c1F |
| InChI | InChI=1S/C25H27FN4O3/c1-25(33)14-30(13-16-3-2-9-27-16)10-8-20(25)18-4-6-21-19(23(18)26)11-15(12-28-21)17-5-7-22(31)29-24(17)32/h2-4,6,9,11-12,17,20,27,33H,5,7-8,10,13-14H2,1H3,(H,29,31,32) |
| InChIKey | XJDMZWGDTGRKMW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|