C22H25N3O3S — CID 177019432
N-[[4-[(3E)-5-iminohepta-1,3,6-trien-3-yl]-2-pyridinyl]methyl]-4-methyl-3-methylsulfonylbenzamide;molecular hydrogen (PubChem CID 177019432) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is N-[[4-[(3E)-5-iminohepta-1,3,6-trien-3-yl]-2-pyridinyl]methyl]-4-methyl-3-methylsulfonylbenzamide;molecular hydrogen.
| Compound Name | N-[[4-[(3E)-5-iminohepta-1,3,6-trien-3-yl]-2-pyridinyl]methyl]-4-methyl-3-methylsulfonylbenzamide;molecular hydrogen |
|---|---|
| PubChem CID | 177019432 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N-[[4-[(3E)-5-iminohepta-1,3,6-trien-3-yl]-2-pyridinyl]methyl]-4-methyl-3-methylsulfonylbenzamide;molecular hydrogen |
| SMILES | [H]/N=C(C=C)/C=C(\C=C)c1ccnc(CNC(=O)c2ccc(C)c(S(C)(=O)=O)c2)c1.[H][H] |
| InChI | InChI=1S/C22H23N3O3S.H2/c1-5-16(11-19(23)6-2)17-9-10-24-20(12-17)14-25-22(26)18-8-7-15(3)21(13-18)29(4,27)28;/h5-13,23H,1-2,14H2,3-4H3,(H,25,26);1H/b16-11+,23-19+; |
| InChIKey | KGOBTUPMMKMJKT-JWNFBNNQSA-N |
| XLogP | 3.74 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|