C24H22N2O3S — CID 177019460
(E)-3-[4-[2-[[(4-methyl-3-methylsulfanylbenzoyl)amino]methyl]-4-pyridinyl]phenyl]prop-2-enoic acid (PubChem CID 177019460) has the molecular formula C24H22N2O3S and a molecular weight of 418.52 g/mol. Its IUPAC name is (E)-3-[4-[2-[[(4-methyl-3-methylsulfanylbenzoyl)amino]methyl]-4-pyridinyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-[[(4-methyl-3-methylsulfanylbenzoyl)amino]methyl]-4-pyridinyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 177019460 |
| Molecular Formula | C24H22N2O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (E)-3-[4-[2-[[(4-methyl-3-methylsulfanylbenzoyl)amino]methyl]-4-pyridinyl]phenyl]prop-2-enoic acid |
| SMILES | CSc1cc(C(=O)NCc2cc(-c3ccc(/C=C/C(=O)O)cc3)ccn2)ccc1C |
| InChI | InChI=1S/C24H22N2O3S/c1-16-3-7-20(14-22(16)30-2)24(29)26-15-21-13-19(11-12-25-21)18-8-4-17(5-9-18)6-10-23(27)28/h3-14H,15H2,1-2H3,(H,26,29)(H,27,28)/b10-6+ |
| InChIKey | RGOVSDILQBIZCH-UXBLZVDNSA-N |
| XLogP | 4.81 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|