C29H29N2O2PS — CID 177019605
N-[[4-[3-(3-dimethylphosphorylphenyl)phenyl]-2-pyridinyl]methyl]-4-methyl-3-methylsulfanylbenzamide (PubChem CID 177019605) has the molecular formula C29H29N2O2PS and a molecular weight of 500.60 g/mol. Its IUPAC name is N-[[4-[3-(3-dimethylphosphorylphenyl)phenyl]-2-pyridinyl]methyl]-4-methyl-3-methylsulfanylbenzamide.
| Compound Name | N-[[4-[3-(3-dimethylphosphorylphenyl)phenyl]-2-pyridinyl]methyl]-4-methyl-3-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 177019605 |
| Molecular Formula | C29H29N2O2PS |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | N-[[4-[3-(3-dimethylphosphorylphenyl)phenyl]-2-pyridinyl]methyl]-4-methyl-3-methylsulfanylbenzamide |
| SMILES | CSc1cc(C(=O)NCc2cc(-c3cccc(-c4cccc(P(C)(C)=O)c4)c3)ccn2)ccc1C |
| InChI | InChI=1S/C29H29N2O2PS/c1-20-11-12-25(18-28(20)35-4)29(32)31-19-26-16-24(13-14-30-26)22-8-5-7-21(15-22)23-9-6-10-27(17-23)34(2,3)33/h5-18H,19H2,1-4H3,(H,31,32) |
| InChIKey | KDKMRKCZDPGETC-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|