C28H28N2O2S — CID 177019469
N-[[4-(3-cyclohexa-1,5-dien-1-ylphenyl)-2-pyridinyl]methyl]-3-(methoxymethylsulfanyl)-4-methylbenzamide (PubChem CID 177019469) has the molecular formula C28H28N2O2S and a molecular weight of 456.61 g/mol. Its IUPAC name is N-[[4-(3-cyclohexa-1,5-dien-1-ylphenyl)-2-pyridinyl]methyl]-3-(methoxymethylsulfanyl)-4-methylbenzamide.
| Compound Name | N-[[4-(3-cyclohexa-1,5-dien-1-ylphenyl)-2-pyridinyl]methyl]-3-(methoxymethylsulfanyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 177019469 |
| Molecular Formula | C28H28N2O2S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | N-[[4-(3-cyclohexa-1,5-dien-1-ylphenyl)-2-pyridinyl]methyl]-3-(methoxymethylsulfanyl)-4-methylbenzamide |
| SMILES | COCSc1cc(C(=O)NCc2cc(-c3cccc(C4=CCCC=C4)c3)ccn2)ccc1C |
| InChI | InChI=1S/C28H28N2O2S/c1-20-11-12-25(17-27(20)33-19-32-2)28(31)30-18-26-16-24(13-14-29-26)23-10-6-9-22(15-23)21-7-4-3-5-8-21/h4,6-17H,3,5,18-19H2,1-2H3,(H,30,31) |
| InChIKey | CYGJJDLRGHEVIH-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|