C25H29FO2 — CID 177019876
(3E)-3-[(4-fluoro-2-methylphenyl)-(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]hept-1-ene-1,2-diol (PubChem CID 177019876) has the molecular formula C25H29FO2 and a molecular weight of 380.50 g/mol. Its IUPAC name is (3E)-3-[(4-fluoro-2-methylphenyl)-(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]hept-1-ene-1,2-diol.
| Compound Name | (3E)-3-[(4-fluoro-2-methylphenyl)-(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]hept-1-ene-1,2-diol |
|---|---|
| PubChem CID | 177019876 |
| Molecular Formula | C25H29FO2 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (3E)-3-[(4-fluoro-2-methylphenyl)-(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]hept-1-ene-1,2-diol |
| SMILES | CCCC/C(C(O)=CO)=C(/c1ccc2c(c1)CCCC2)c1ccc(F)cc1C |
| InChI | InChI=1S/C25H29FO2/c1-3-4-9-23(24(28)16-27)25(22-13-12-21(26)14-17(22)2)20-11-10-18-7-5-6-8-19(18)15-20/h10-16,27-28H,3-9H2,1-2H3/b24-16?,25-23+ |
| InChIKey | LENUSVLKEDBNGD-KLIYTCBDSA-N |
| XLogP | 6.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|