C31H49N5 — CID 177020713
3-[7-[4-[(2S)-5-cyclohexylpentan-2-yl]piperazin-1-yl]-1-methylindazol-3-yl]-N-methylhepta-1,6-dien-2-amine (PubChem CID 177020713) has the molecular formula C31H49N5 and a molecular weight of 491.77 g/mol. Its IUPAC name is 3-[7-[4-[(2S)-5-cyclohexylpentan-2-yl]piperazin-1-yl]-1-methylindazol-3-yl]-N-methylhepta-1,6-dien-2-amine.
| Compound Name | 3-[7-[4-[(2S)-5-cyclohexylpentan-2-yl]piperazin-1-yl]-1-methylindazol-3-yl]-N-methylhepta-1,6-dien-2-amine |
|---|---|
| PubChem CID | 177020713 |
| Molecular Formula | C31H49N5 |
| Molecular Weight | 491.77 g/mol |
| Exact Mass | 491.40 |
| IUPAC Name | 3-[7-[4-[(2S)-5-cyclohexylpentan-2-yl]piperazin-1-yl]-1-methylindazol-3-yl]-N-methylhepta-1,6-dien-2-amine |
| SMILES | C=CCCC(C(=C)NC)c1nn(C)c2c(N3CCN([C@@H](C)CCCC4CCCCC4)CC3)cccc12 |
| InChI | InChI=1S/C31H49N5/c1-6-7-17-27(25(3)32-4)30-28-18-12-19-29(31(28)34(5)33-30)36-22-20-35(21-23-36)24(2)13-11-16-26-14-9-8-10-15-26/h6,12,18-19,24,26-27,32H,1,3,7-11,13-17,20-23H2,2,4-5H3/t24-,27?/m0/s1 |
| InChIKey | HFMNPALTMSSQNP-BXXZMZEQSA-N |
| XLogP | 6.62 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.77 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|