C10H9Cl3N2 — CID 177022060
6-chloro-2-(1,1-dichloroethyl)-4-methyl-1H-benzimidazole (PubChem CID 177022060) has the molecular formula C10H9Cl3N2 and a molecular weight of 263.56 g/mol. Its IUPAC name is 6-chloro-2-(1,1-dichloroethyl)-4-methyl-1H-benzimidazole.
| Compound Name | 6-chloro-2-(1,1-dichloroethyl)-4-methyl-1H-benzimidazole |
|---|---|
| PubChem CID | 177022060 |
| Molecular Formula | C10H9Cl3N2 |
| Molecular Weight | 263.56 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | 6-chloro-2-(1,1-dichloroethyl)-4-methyl-1H-benzimidazole |
| SMILES | Cc1cc(Cl)cc2[nH]c(C(C)(Cl)Cl)nc12 |
| InChI | InChI=1S/C10H9Cl3N2/c1-5-3-6(11)4-7-8(5)15-9(14-7)10(2,12)13/h3-4H,1-2H3,(H,14,15) |
| InChIKey | PTSDFWFLEDZUQP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|