C12H24N2 — CID 177022130
N,2-dimethyl-3-propan-2-ylidenepiperidin-4-imine;ethane (PubChem CID 177022130) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is N,2-dimethyl-3-propan-2-ylidenepiperidin-4-imine;ethane.
| Compound Name | N,2-dimethyl-3-propan-2-ylidenepiperidin-4-imine;ethane |
|---|---|
| PubChem CID | 177022130 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N,2-dimethyl-3-propan-2-ylidenepiperidin-4-imine;ethane |
| SMILES | C/N=C1\CCNC(C)C1=C(C)C.CC |
| InChI | InChI=1S/C10H18N2.C2H6/c1-7(2)10-8(3)12-6-5-9(10)11-4;1-2/h8,12H,5-6H2,1-4H3;1-2H3/b11-9+; |
| InChIKey | UOTOLIGSORBOEU-LBEJWNQZSA-N |
| XLogP | 2.80 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|