C10H17FN2 — CID 177021763
(3E)-3-(1-fluoropropylidene)-N,2-dimethylpiperidin-4-imine (PubChem CID 177021763) has the molecular formula C10H17FN2 and a molecular weight of 184.26 g/mol. Its IUPAC name is (3E)-3-(1-fluoropropylidene)-N,2-dimethylpiperidin-4-imine.
| Compound Name | (3E)-3-(1-fluoropropylidene)-N,2-dimethylpiperidin-4-imine |
|---|---|
| PubChem CID | 177021763 |
| Molecular Formula | C10H17FN2 |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.14 |
| IUPAC Name | (3E)-3-(1-fluoropropylidene)-N,2-dimethylpiperidin-4-imine |
| SMILES | CC/C(F)=C1C(=N\C)\CCNC\1C |
| InChI | InChI=1S/C10H17FN2/c1-4-8(11)10-7(2)13-6-5-9(10)12-3/h7,13H,4-6H2,1-3H3/b10-8+,12-9+ |
| InChIKey | CWJKPVVVMYPLRV-AXDLQRQNSA-N |
| XLogP | 2.07 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|