C10H18N2 — CID 177022131
N,2-dimethyl-3-propan-2-ylidenepiperidin-4-imine (PubChem CID 177022131) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N,2-dimethyl-3-propan-2-ylidenepiperidin-4-imine.
| Compound Name | N,2-dimethyl-3-propan-2-ylidenepiperidin-4-imine |
|---|---|
| PubChem CID | 177022131 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N,2-dimethyl-3-propan-2-ylidenepiperidin-4-imine |
| SMILES | C/N=C1\CCNC(C)C1=C(C)C |
| InChI | InChI=1S/C10H18N2/c1-7(2)10-8(3)12-6-5-9(10)11-4/h8,12H,5-6H2,1-4H3/b11-9+ |
| InChIKey | QJFNOTRCZZLXPM-PKNBQFBNSA-N |
| XLogP | 1.78 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|