C20H25FN4O2 — CID 177022767
2-[(Z)-1-amino-2-(2-amino-5-methyl-1H-pyrrol-3-yl)ethenyl]phenol;1-(3-fluoropyrrolidin-1-yl)prop-2-en-1-one (PubChem CID 177022767) has the molecular formula C20H25FN4O2 and a molecular weight of 372.44 g/mol. Its IUPAC name is 2-[(Z)-1-amino-2-(2-amino-5-methyl-1H-pyrrol-3-yl)ethenyl]phenol;1-(3-fluoropyrrolidin-1-yl)prop-2-en-1-one.
| Compound Name | 2-[(Z)-1-amino-2-(2-amino-5-methyl-1H-pyrrol-3-yl)ethenyl]phenol;1-(3-fluoropyrrolidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 177022767 |
| Molecular Formula | C20H25FN4O2 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 2-[(Z)-1-amino-2-(2-amino-5-methyl-1H-pyrrol-3-yl)ethenyl]phenol;1-(3-fluoropyrrolidin-1-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(F)C1.Cc1cc(/C=C(\N)c2ccccc2O)c(N)[nH]1 |
| InChI | InChI=1S/C13H15N3O.C7H10FNO/c1-8-6-9(13(15)16-8)7-11(14)10-4-2-3-5-12(10)17;1-2-7(10)9-4-3-6(8)5-9/h2-7,16-17H,14-15H2,1H3;2,6H,1,3-5H2/b11-7-; |
| InChIKey | OHDCMMVRYXIBSD-AJULUCINSA-N |
| XLogP | 2.81 |
| TPSA | 108.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|