C21H28N4O2 — CID 177022871
4-[5-amino-4-[(Z)-2-amino-2-(2-hydroxyphenyl)ethenyl]-1H-pyrrol-2-yl]piperidine-1-carbaldehyde;prop-1-ene (PubChem CID 177022871) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 4-[5-amino-4-[(Z)-2-amino-2-(2-hydroxyphenyl)ethenyl]-1H-pyrrol-2-yl]piperidine-1-carbaldehyde;prop-1-ene.
| Compound Name | 4-[5-amino-4-[(Z)-2-amino-2-(2-hydroxyphenyl)ethenyl]-1H-pyrrol-2-yl]piperidine-1-carbaldehyde;prop-1-ene |
|---|---|
| PubChem CID | 177022871 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 4-[5-amino-4-[(Z)-2-amino-2-(2-hydroxyphenyl)ethenyl]-1H-pyrrol-2-yl]piperidine-1-carbaldehyde;prop-1-ene |
| SMILES | C=CC.N/C(=C\c1cc(C2CCN(C=O)CC2)[nH]c1N)c1ccccc1O |
| InChI | InChI=1S/C18H22N4O2.C3H6/c19-15(14-3-1-2-4-17(14)24)9-13-10-16(21-18(13)20)12-5-7-22(11-23)8-6-12;1-3-2/h1-4,9-12,21,24H,5-8,19-20H2;3H,1H2,2H3/b15-9-; |
| InChIKey | XCBPIISJMRQBCB-SOCRLDLMSA-N |
| XLogP | 3.29 |
| TPSA | 108.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|