C23H34N4O2 — CID 177023703
2-[(Z)-1-amino-2-[2-amino-4-methyl-5-(1-methylpyrrolidin-3-yl)-1H-pyrrol-3-yl]ethenyl]phenol;ethane;prop-2-enal (PubChem CID 177023703) has the molecular formula C23H34N4O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is 2-[(Z)-1-amino-2-[2-amino-4-methyl-5-(1-methylpyrrolidin-3-yl)-1H-pyrrol-3-yl]ethenyl]phenol;ethane;prop-2-enal.
| Compound Name | 2-[(Z)-1-amino-2-[2-amino-4-methyl-5-(1-methylpyrrolidin-3-yl)-1H-pyrrol-3-yl]ethenyl]phenol;ethane;prop-2-enal |
|---|---|
| PubChem CID | 177023703 |
| Molecular Formula | C23H34N4O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 2-[(Z)-1-amino-2-[2-amino-4-methyl-5-(1-methylpyrrolidin-3-yl)-1H-pyrrol-3-yl]ethenyl]phenol;ethane;prop-2-enal |
| SMILES | C=CC=O.CC.Cc1c(C2CCN(C)C2)[nH]c(N)c1/C=C(\N)c1ccccc1O |
| InChI | InChI=1S/C18H24N4O.C3H4O.C2H6/c1-11-14(9-15(19)13-5-3-4-6-16(13)23)18(20)21-17(11)12-7-8-22(2)10-12;1-2-3-4;1-2/h3-6,9,12,21,23H,7-8,10,19-20H2,1-2H3;2-3H,1H2;1-2H3/b15-9-;; |
| InChIKey | MMLNSONRBUMYRB-OCVBWICTSA-N |
| XLogP | 3.88 |
| TPSA | 108.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|